About (8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate
(8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate (PubChem CID 163445773) has the molecular formula C20H32O4
and a molecular weight of 336.47 g/mol. Its IUPAC name is (8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate.
Molecular Properties
| Compound Name | (8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate |
| PubChem CID | 163445773 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)OC1C2OC(=O)C3CC1C(C)(C)C32)C(C)(C)C |
| InChI | InChI=1S/C20H32O4/c1-10(2)8-13(19(3,4)5)18(22)23-15-12-9-11-14(20(12,6)7)16(15)24-17(11)21/h10-16H,8-9H2,1-7H3 |
| InChIKey | MUPNSKWRELATAB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate?
The IUPAC name of (8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate (CID 163445773) is (8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate.
What is the SMILES notation for (8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate?
The canonical SMILES for (8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate is CC(C)CC(C(=O)OC1C2OC(=O)C3CC1C(C)(C)C32)C(C)(C)C.
What is the InChIKey of (8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate?
The InChIKey is MUPNSKWRELATAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O4/c1-10(2)8-13(19(3,4)5)18(22)23-15-12-9-11-14(20(12,6)7)16(15)24-17(11)21/h10-16H,8-9H2,1-7H3.
What are the key properties of (8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate?
(8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate has a molecular weight of 336.47 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8,8-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-tert-butyl-4-methylpentanoate is sourced from PubChem (CID 163445773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).