C16H19F2N3O5 — CID 163445880
4-[3-[1-(1-ethoxyethoxy)ethyl]-4-methyl-5-oxo-1,2,4-triazol-1-yl]-2,5-difluorobenzoic acid (PubChem CID 163445880) has the molecular formula C16H19F2N3O5 and a molecular weight of 371.34 g/mol. Its IUPAC name is 4-[3-[1-(1-ethoxyethoxy)ethyl]-4-methyl-5-oxo-1,2,4-triazol-1-yl]-2,5-difluorobenzoic acid.
| Compound Name | 4-[3-[1-(1-ethoxyethoxy)ethyl]-4-methyl-5-oxo-1,2,4-triazol-1-yl]-2,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 163445880 |
| Molecular Formula | C16H19F2N3O5 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 4-[3-[1-(1-ethoxyethoxy)ethyl]-4-methyl-5-oxo-1,2,4-triazol-1-yl]-2,5-difluorobenzoic acid |
| SMILES | CCOC(C)OC(C)c1nn(-c2cc(F)c(C(=O)O)cc2F)c(=O)n1C |
| InChI | InChI=1S/C16H19F2N3O5/c1-5-25-9(3)26-8(2)14-19-21(16(24)20(14)4)13-7-11(17)10(15(22)23)6-12(13)18/h6-9H,5H2,1-4H3,(H,22,23) |
| InChIKey | BCLUPFXSHBZDBU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|