About N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide
N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide (PubChem CID 163446336) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide |
| PubChem CID | 163446336 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide |
| SMILES | CNC(CC(C)(C)C)C(=O)NCC#N |
| InChI | InChI=1S/C10H19N3O/c1-10(2,3)7-8(12-4)9(14)13-6-5-11/h8,12H,6-7H2,1-4H3,(H,13,14) |
| InChIKey | BCVSZVSRGVZKHT-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide?
The IUPAC name of N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide (CID 163446336) is N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide.
What is the SMILES notation for N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide?
The canonical SMILES for N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide is CNC(CC(C)(C)C)C(=O)NCC#N.
What is the InChIKey of N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide?
The InChIKey is BCVSZVSRGVZKHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c1-10(2,3)7-8(12-4)9(14)13-6-5-11/h8,12H,6-7H2,1-4H3,(H,13,14).
What are the key properties of N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide?
N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide has a molecular weight of 197.28 g/mol, XLogP of 0.65, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-4,4-dimethyl-2-(methylamino)pentanamide is sourced from PubChem (CID 163446336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).