About (2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol
(2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol (PubChem CID 163446409) has the molecular formula C12H15F3N2O
and a molecular weight of 260.26 g/mol. Its IUPAC name is (2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol.
Molecular Properties
| Compound Name | (2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol |
| PubChem CID | 163446409 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol |
| SMILES | CC/C=C(O)\C=C(\C)Cn1cnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O/c1-3-4-10(18)5-9(2)6-17-7-11(16-8-17)12(13,14)15/h4-5,7-8,18H,3,6H2,1-2H3/b9-5-,10-4+ |
| InChIKey | BCXAMYKWNLNZGP-LPTSPAKCSA-N |
| XLogP | 3.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol?
The IUPAC name of (2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol (CID 163446409) is (2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol.
What is the SMILES notation for (2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol?
The canonical SMILES for (2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol is CC/C=C(O)\C=C(\C)Cn1cnc(C(F)(F)F)c1.
What is the InChIKey of (2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol?
The InChIKey is BCXAMYKWNLNZGP-LPTSPAKCSA-N. The full InChI is InChI=1S/C12H15F3N2O/c1-3-4-10(18)5-9(2)6-17-7-11(16-8-17)12(13,14)15/h4-5,7-8,18H,3,6H2,1-2H3/b9-5-,10-4+.
What are the key properties of (2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol?
(2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol has a molecular weight of 260.26 g/mol, XLogP of 3.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-2-methyl-1-[4-(trifluoromethyl)imidazol-1-yl]hepta-2,4-dien-4-ol is sourced from PubChem (CID 163446409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).