C13H20O5 — CID 163446490
methyl 2-[(3S,4R,4aR,6R,8aS)-3,4-dimethyl-2-oxo-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-6-yl]acetate (PubChem CID 163446490) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl 2-[(3S,4R,4aR,6R,8aS)-3,4-dimethyl-2-oxo-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-6-yl]acetate.
| Compound Name | methyl 2-[(3S,4R,4aR,6R,8aS)-3,4-dimethyl-2-oxo-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-6-yl]acetate |
|---|---|
| PubChem CID | 163446490 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | methyl 2-[(3S,4R,4aR,6R,8aS)-3,4-dimethyl-2-oxo-4,4a,6,7,8,8a-hexahydro-3H-pyrano[3,2-b]pyran-6-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@@H]2OC(=O)[C@@H](C)[C@@H](C)[C@H]2O1 |
| InChI | InChI=1S/C13H20O5/c1-7-8(2)13(15)18-10-5-4-9(17-12(7)10)6-11(14)16-3/h7-10,12H,4-6H2,1-3H3/t7-,8+,9-,10+,12-/m1/s1 |
| InChIKey | KZOBWDNWSSXHFH-RACFRTOFSA-N |
| XLogP | 1.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |