C23H22F7N3O2S — CID 163446953
1-cyclopropyl-3-[[1-(4-fluorophenyl)sulfanyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]methyl]urea (PubChem CID 163446953) has the molecular formula C23H22F7N3O2S and a molecular weight of 537.50 g/mol. Its IUPAC name is 1-cyclopropyl-3-[[1-(4-fluorophenyl)sulfanyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]methyl]urea.
| Compound Name | 1-cyclopropyl-3-[[1-(4-fluorophenyl)sulfanyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 163446953 |
| Molecular Formula | C23H22F7N3O2S |
| Molecular Weight | 537.50 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | 1-cyclopropyl-3-[[1-(4-fluorophenyl)sulfanyl-6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-3,4-dihydro-2H-quinolin-2-yl]methyl]urea |
| SMILES | O=C(NCC1CCc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc2N1Sc1ccc(F)cc1)NC1CC1 |
| InChI | InChI=1S/C23H22F7N3O2S/c24-15-3-8-18(9-4-15)36-33-17(12-31-20(34)32-16-5-6-16)7-1-13-11-14(2-10-19(13)33)21(35,22(25,26)27)23(28,29)30/h2-4,8-11,16-17,35H,1,5-7,12H2,(H2,31,32,34) |
| InChIKey | BDHSNCWISHWTNY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|