C16H21N2O6+ — CID 163447391
(2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(1-methyl-2,5-dioxopyrrol-1-ium-1-yl)pentanoate (PubChem CID 163447391) has the molecular formula C16H21N2O6+ and a molecular weight of 337.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(1-methyl-2,5-dioxopyrrol-1-ium-1-yl)pentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(1-methyl-2,5-dioxopyrrol-1-ium-1-yl)pentanoate |
|---|---|
| PubChem CID | 163447391 |
| Molecular Formula | C16H21N2O6+ |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(1-methyl-2,5-dioxopyrrol-1-ium-1-yl)pentanoate |
| SMILES | CC(CC(C)(C)C(=O)ON1C(=O)CCC1=O)[N+]1(C)C(=O)C=CC1=O |
| InChI | InChI=1S/C16H21N2O6/c1-10(18(4)13(21)7-8-14(18)22)9-16(2,3)15(23)24-17-11(19)5-6-12(17)20/h7-8,10H,5-6,9H2,1-4H3/q+1 |
| InChIKey | YDDWUUFPZOUNPY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|