C28H30N2O7 — CID 163447478
(1R,2R,3R,8bS)-3-cyclohexa-2,4-dien-1-yl-6-ethenoxy-1,8b-dihydroxy-8-methoxy-3a-(4-methoxyphenyl)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carbohydrazide (PubChem CID 163447478) has the molecular formula C28H30N2O7 and a molecular weight of 506.56 g/mol. Its IUPAC name is (1R,2R,3R,8bS)-3-cyclohexa-2,4-dien-1-yl-6-ethenoxy-1,8b-dihydroxy-8-methoxy-3a-(4-methoxyphenyl)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carbohydrazide.
| Compound Name | (1R,2R,3R,8bS)-3-cyclohexa-2,4-dien-1-yl-6-ethenoxy-1,8b-dihydroxy-8-methoxy-3a-(4-methoxyphenyl)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 163447478 |
| Molecular Formula | C28H30N2O7 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (1R,2R,3R,8bS)-3-cyclohexa-2,4-dien-1-yl-6-ethenoxy-1,8b-dihydroxy-8-methoxy-3a-(4-methoxyphenyl)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carbohydrazide |
| SMILES | C=COc1cc(OC)c2c(c1)OC1(c3ccc(OC)cc3)[C@H](C3C=CC=CC3)[C@@H](C(=O)NN)[C@@H](O)[C@@]21O |
| InChI | InChI=1S/C28H30N2O7/c1-4-36-19-14-20(35-3)24-21(15-19)37-28(17-10-12-18(34-2)13-11-17)23(16-8-6-5-7-9-16)22(26(32)30-29)25(31)27(24,28)33/h4-8,10-16,22-23,25,31,33H,1,9,29H2,2-3H3,(H,30,32)/t16?,22-,23-,25-,27+,28?/m1/s1 |
| InChIKey | BDSVOIZAKPHLJC-ABBXZMIKSA-N |
| XLogP | 2.43 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|