C8H12O2 — CID 163447650
1-(2,3-dihydrofuran-3-yl)butan-1-one (PubChem CID 163447650) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-3-yl)butan-1-one.
| Compound Name | 1-(2,3-dihydrofuran-3-yl)butan-1-one |
|---|---|
| PubChem CID | 163447650 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 1-(2,3-dihydrofuran-3-yl)butan-1-one |
| SMILES | CCCC(=O)C1C=COC1 |
| InChI | InChI=1S/C8H12O2/c1-2-3-8(9)7-4-5-10-6-7/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | BDWDCSWPVVJDON-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |