C21H32N2O — CID 163447840
(10R,13S)-10,13-dimethylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,2'-imidazolidine]-17-one (PubChem CID 163447840) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is (10R,13S)-10,13-dimethylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,2'-imidazolidine]-17-one.
| Compound Name | (10R,13S)-10,13-dimethylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,2'-imidazolidine]-17-one |
|---|---|
| PubChem CID | 163447840 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | (10R,13S)-10,13-dimethylspiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,2'-imidazolidine]-17-one |
| SMILES | C[C@]12CCC3(C=C1CCC1C2CC[C@]2(C)C(=O)CCC12)NCCN3 |
| InChI | InChI=1S/C21H32N2O/c1-19-9-10-21(22-11-12-23-21)13-14(19)3-4-15-16-5-6-18(24)20(16,2)8-7-17(15)19/h13,15-17,22-23H,3-12H2,1-2H3/t15?,16?,17?,19-,20-/m0/s1 |
| InChIKey | BEACRJUVJIXWFV-GTSVPISWSA-N |
| XLogP | 3.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|