C36H46FN3O5 — CID 163447999
(2S,3R,4S)-4-(2,3-dihydro-1-benzofuran-5-yl)-1-[2-(4-fluoro-N-heptan-4-yl-3-methylanilino)-2-oxoethyl]-2-[3-(5-methyl-1,3-oxazol-2-yl)propyl]pyrrolidine-3-carboxylic acid (PubChem CID 163447999) has the molecular formula C36H46FN3O5 and a molecular weight of 619.78 g/mol. Its IUPAC name is (2S,3R,4S)-4-(2,3-dihydro-1-benzofuran-5-yl)-1-[2-(4-fluoro-N-heptan-4-yl-3-methylanilino)-2-oxoethyl]-2-[3-(5-methyl-1,3-oxazol-2-yl)propyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3R,4S)-4-(2,3-dihydro-1-benzofuran-5-yl)-1-[2-(4-fluoro-N-heptan-4-yl-3-methylanilino)-2-oxoethyl]-2-[3-(5-methyl-1,3-oxazol-2-yl)propyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 163447999 |
| Molecular Formula | C36H46FN3O5 |
| Molecular Weight | 619.78 g/mol |
| Exact Mass | 619.34 |
| IUPAC Name | (2S,3R,4S)-4-(2,3-dihydro-1-benzofuran-5-yl)-1-[2-(4-fluoro-N-heptan-4-yl-3-methylanilino)-2-oxoethyl]-2-[3-(5-methyl-1,3-oxazol-2-yl)propyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCCC(CCC)N(C(=O)CN1C[C@H](c2ccc3c(c2)CCO3)[C@@H](C(=O)O)[C@@H]1CCCc1ncc(C)o1)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C36H46FN3O5/c1-5-8-27(9-6-2)40(28-13-14-30(37)23(3)18-28)34(41)22-39-21-29(25-12-15-32-26(19-25)16-17-44-32)35(36(42)43)31(39)10-7-11-33-38-20-24(4)45-33/h12-15,18-20,27,29,31,35H,5-11,16-17,21-22H2,1-4H3,(H,42,43)/t29-,31+,35-/m1/s1 |
| InChIKey | BEDOHVQNGDDKKK-FTGJPXSISA-N |
| XLogP | 6.86 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.78 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |