About 4-amino-5,5-difluoropentan-2-one
4-amino-5,5-difluoropentan-2-one (PubChem CID 163448252) has the molecular formula C5H9F2NO
and a molecular weight of 137.13 g/mol. Its IUPAC name is 4-amino-5,5-difluoropentan-2-one.
Molecular Properties
| Compound Name | 4-amino-5,5-difluoropentan-2-one |
| PubChem CID | 163448252 |
| Molecular Formula | C5H9F2NO |
| Molecular Weight | 137.13 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | 4-amino-5,5-difluoropentan-2-one |
| SMILES | CC(=O)CC(N)C(F)F |
| InChI | InChI=1S/C5H9F2NO/c1-3(9)2-4(8)5(6)7/h4-5H,2,8H2,1H3 |
| InChIKey | BEIWGIWYOABQRL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.13 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-5,5-difluoropentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5,5-difluoropentan-2-one?
The IUPAC name of 4-amino-5,5-difluoropentan-2-one (CID 163448252) is 4-amino-5,5-difluoropentan-2-one.
What is the SMILES notation for 4-amino-5,5-difluoropentan-2-one?
The canonical SMILES for 4-amino-5,5-difluoropentan-2-one is CC(=O)CC(N)C(F)F.
What is the InChIKey of 4-amino-5,5-difluoropentan-2-one?
The InChIKey is BEIWGIWYOABQRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2NO/c1-3(9)2-4(8)5(6)7/h4-5H,2,8H2,1H3.
What are the key properties of 4-amino-5,5-difluoropentan-2-one?
4-amino-5,5-difluoropentan-2-one has a molecular weight of 137.13 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5,5-difluoropentan-2-one is sourced from PubChem (CID 163448252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).