About N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide
N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 163449157) has the molecular formula C10H12IN3O2S
and a molecular weight of 365.20 g/mol. Its IUPAC name is N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide.
Molecular Properties
| Compound Name | N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| PubChem CID | 163449157 |
| Molecular Formula | C10H12IN3O2S |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | O=C(CCCCc1scc2[nH]c(=O)[nH]c12)NI |
| InChI | InChI=1S/C10H12IN3O2S/c11-14-8(15)4-2-1-3-7-9-6(5-17-7)12-10(16)13-9/h5H,1-4H2,(H,14,15)(H2,12,13,16) |
| InChIKey | BFCQHWLQTPOBOL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide?
The IUPAC name of N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide (CID 163449157) is N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide.
What is the SMILES notation for N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide?
The canonical SMILES for N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide is O=C(CCCCc1scc2[nH]c(=O)[nH]c12)NI.
What is the InChIKey of N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide?
The InChIKey is BFCQHWLQTPOBOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12IN3O2S/c11-14-8(15)4-2-1-3-7-9-6(5-17-7)12-10(16)13-9/h5H,1-4H2,(H,14,15)(H2,12,13,16).
What are the key properties of N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide?
N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide has a molecular weight of 365.20 g/mol, XLogP of 2.10, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-iodo-5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanamide is sourced from PubChem (CID 163449157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).