C14H19NO2 — CID 163449445
ethyl (2S,3S)-2-benzylpyrrolidine-3-carboxylate (PubChem CID 163449445) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is ethyl (2S,3S)-2-benzylpyrrolidine-3-carboxylate.
| Compound Name | ethyl (2S,3S)-2-benzylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 163449445 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | ethyl (2S,3S)-2-benzylpyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCN[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-2-17-14(16)12-8-9-15-13(12)10-11-6-4-3-5-7-11/h3-7,12-13,15H,2,8-10H2,1H3/t12-,13-/m0/s1 |
| InChIKey | BFJAEVWPEHNZRH-STQMWFEESA-N |
| XLogP | 1.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |