C41H32N2O3S2 — CID 163450310
2-[(5Z)-5-[[4-[5-(4-ethylphenyl)-7,7-dimethylindeno[2,1-b]carbazol-2-yl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 163450310) has the molecular formula C41H32N2O3S2 and a molecular weight of 664.85 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-[5-(4-ethylphenyl)-7,7-dimethylindeno[2,1-b]carbazol-2-yl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[4-[5-(4-ethylphenyl)-7,7-dimethylindeno[2,1-b]carbazol-2-yl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 163450310 |
| Molecular Formula | C41H32N2O3S2 |
| Molecular Weight | 664.85 g/mol |
| Exact Mass | 664.19 |
| IUPAC Name | 2-[(5Z)-5-[[4-[5-(4-ethylphenyl)-7,7-dimethylindeno[2,1-b]carbazol-2-yl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCc1ccc(-n2c3ccc(-c4ccc(/C=C5\SC(=S)N(CC(=O)O)C5=O)cc4)cc3c3cc4c(cc32)C(C)(C)c2ccccc2-4)cc1 |
| InChI | InChI=1S/C41H32N2O3S2/c1-4-24-11-16-28(17-12-24)43-35-18-15-27(26-13-9-25(10-14-26)19-37-39(46)42(23-38(44)45)40(47)48-37)20-31(35)32-21-30-29-7-5-6-8-33(29)41(2,3)34(30)22-36(32)43/h5-22H,4,23H2,1-3H3,(H,44,45)/b37-19- |
| InChIKey | BGAQNPJCAIHFMB-KOKCXWAISA-N |
| XLogP | 9.61 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.85 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|