About 4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine
4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine (PubChem CID 163451182) has the molecular formula C11H13F4N
and a molecular weight of 235.22 g/mol. Its IUPAC name is 4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine |
| PubChem CID | 163451182 |
| Molecular Formula | C11H13F4N |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine |
| SMILES | C/C(F)=C\CC1=CC=C(N)CC1C(F)(F)F |
| InChI | InChI=1S/C11H13F4N/c1-7(12)2-3-8-4-5-9(16)6-10(8)11(13,14)15/h2,4-5,10H,3,6,16H2,1H3/b7-2+ |
| InChIKey | BGSXQAMZUGSQDC-FARCUNLSSA-N |
| XLogP | 3.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
The IUPAC name of 4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine (CID 163451182) is 4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
The canonical SMILES for 4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine is C/C(F)=C\CC1=CC=C(N)CC1C(F)(F)F.
What is the InChIKey of 4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
The InChIKey is BGSXQAMZUGSQDC-FARCUNLSSA-N. The full InChI is InChI=1S/C11H13F4N/c1-7(12)2-3-8-4-5-9(16)6-10(8)11(13,14)15/h2,4-5,10H,3,6,16H2,1H3/b7-2+.
What are the key properties of 4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine?
4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine has a molecular weight of 235.22 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-3-fluorobut-2-enyl]-5-(trifluoromethyl)cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 163451182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).