C13H23NO — CID 163451335
4-(4-methylcyclohexyl)oxycyclohex-2-en-1-amine (PubChem CID 163451335) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 4-(4-methylcyclohexyl)oxycyclohex-2-en-1-amine.
| Compound Name | 4-(4-methylcyclohexyl)oxycyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 163451335 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 4-(4-methylcyclohexyl)oxycyclohex-2-en-1-amine |
| SMILES | CC1CCC(OC2C=CC(N)CC2)CC1 |
| InChI | InChI=1S/C13H23NO/c1-10-2-6-12(7-3-10)15-13-8-4-11(14)5-9-13/h4,8,10-13H,2-3,5-7,9,14H2,1H3 |
| InChIKey | BGWAJJIWOCOQGJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|