C16H17BO2S2 — CID 163452098
1-hydroxy-8-(4-methylsulfanylphenyl)sulfanyl-3,5-dihydro-2H-4,1-benzoxaborepine (PubChem CID 163452098) has the molecular formula C16H17BO2S2 and a molecular weight of 316.26 g/mol. Its IUPAC name is 1-hydroxy-8-(4-methylsulfanylphenyl)sulfanyl-3,5-dihydro-2H-4,1-benzoxaborepine.
| Compound Name | 1-hydroxy-8-(4-methylsulfanylphenyl)sulfanyl-3,5-dihydro-2H-4,1-benzoxaborepine |
|---|---|
| PubChem CID | 163452098 |
| Molecular Formula | C16H17BO2S2 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 1-hydroxy-8-(4-methylsulfanylphenyl)sulfanyl-3,5-dihydro-2H-4,1-benzoxaborepine |
| SMILES | CSc1ccc(Sc2ccc3c(c2)B(O)CCOC3)cc1 |
| InChI | InChI=1S/C16H17BO2S2/c1-20-13-4-6-14(7-5-13)21-15-3-2-12-11-19-9-8-17(18)16(12)10-15/h2-7,10,18H,8-9,11H2,1H3 |
| InChIKey | BHLJIPSUJVXZSK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|