C24H37N3O4 — CID 163452205
(3S,4R,5R)-2-[(3-aminophenyl)methyl]-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-N-[(1S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide (PubChem CID 163452205) has the molecular formula C24H37N3O4 and a molecular weight of 431.58 g/mol. Its IUPAC name is (3S,4R,5R)-2-[(3-aminophenyl)methyl]-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-N-[(1S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide.
| Compound Name | (3S,4R,5R)-2-[(3-aminophenyl)methyl]-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-N-[(1S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 163452205 |
| Molecular Formula | C24H37N3O4 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | (3S,4R,5R)-2-[(3-aminophenyl)methyl]-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-N-[(1S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide |
| SMILES | CC1[C@@H](NC(=O)[C@@H]2[C@H]([C@H](C)O)[C@H](CO)ON2Cc2cccc(N)c2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C24H37N3O4/c1-13-18-9-16(24(18,3)4)10-19(13)26-23(30)22-21(14(2)29)20(12-28)31-27(22)11-15-6-5-7-17(25)8-15/h5-8,13-14,16,18-22,28-29H,9-12,25H2,1-4H3,(H,26,30)/t13?,14-,16+,18-,19-,20-,21+,22-/m0/s1 |
| InChIKey | BHNBKFCKTVOOEI-BCDHHZEUSA-N |
| XLogP | 1.93 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|