About 4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol
4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol (PubChem CID 163452959) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 163452959 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol |
| SMILES | CC(C)(C)C1=CC(CO)C(O)C(CO)=C1 |
| InChI | InChI=1S/C12H20O3/c1-12(2,3)10-4-8(6-13)11(15)9(5-10)7-14/h4-5,8,11,13-15H,6-7H2,1-3H3 |
| InChIKey | BIBKGGNYJIABKP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol?
The IUPAC name of 4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol (CID 163452959) is 4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol is CC(C)(C)C1=CC(CO)C(O)C(CO)=C1.
What is the InChIKey of 4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol?
The InChIKey is BIBKGGNYJIABKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-12(2,3)10-4-8(6-13)11(15)9(5-10)7-14/h4-5,8,11,13-15H,6-7H2,1-3H3.
What are the key properties of 4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol?
4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol has a molecular weight of 212.29 g/mol, XLogP of 0.86, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2,6-bis(hydroxymethyl)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 163452959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).