C18H24F3NOS — CID 163453156
2,2,2-trifluoro-1-[2-[4-(2-methylbut-3-enyl)cyclooctyl]-1,3-thiazol-5-yl]ethanone (PubChem CID 163453156) has the molecular formula C18H24F3NOS and a molecular weight of 359.46 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-[4-(2-methylbut-3-enyl)cyclooctyl]-1,3-thiazol-5-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[2-[4-(2-methylbut-3-enyl)cyclooctyl]-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 163453156 |
| Molecular Formula | C18H24F3NOS |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-[4-(2-methylbut-3-enyl)cyclooctyl]-1,3-thiazol-5-yl]ethanone |
| SMILES | C=CC(C)CC1CCCCC(c2ncc(C(=O)C(F)(F)F)s2)CC1 |
| InChI | InChI=1S/C18H24F3NOS/c1-3-12(2)10-13-6-4-5-7-14(9-8-13)17-22-11-15(24-17)16(23)18(19,20)21/h3,11-14H,1,4-10H2,2H3 |
| InChIKey | BIFKNMDMUOLOSA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|