C10H6Cl8 — CID 163453952
(4S)-1,3,4,7,8,9,10,10-octachlorotricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 163453952) has the molecular formula C10H6Cl8 and a molecular weight of 409.78 g/mol. Its IUPAC name is (4S)-1,3,4,7,8,9,10,10-octachlorotricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | (4S)-1,3,4,7,8,9,10,10-octachlorotricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 163453952 |
| Molecular Formula | C10H6Cl8 |
| Molecular Weight | 409.78 g/mol |
| Exact Mass | 405.80 |
| IUPAC Name | (4S)-1,3,4,7,8,9,10,10-octachlorotricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | ClC1=C(Cl)C2(Cl)C3C(Cl)[C@@H](Cl)CC3C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C10H6Cl8/c11-3-1-2-4(5(3)12)9(16)7(14)6(13)8(2,15)10(9,17)18/h2-5H,1H2/t2?,3-,4?,5?,8?,9?/m0/s1 |
| InChIKey | BIWJNBZANLAXMG-MYBQEYQNSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.78 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|