C22H23N4O5S- — CID 163454400
2-[[1-[3-(5-ethyl-7-methoxy-4-oxo-3,1-benzoxazin-2-yl)-2-pyridinyl]-2,3-dihydropyrrol-4-yl]amino]ethanesulfinate (PubChem CID 163454400) has the molecular formula C22H23N4O5S- and a molecular weight of 455.52 g/mol. Its IUPAC name is 2-[[1-[3-(5-ethyl-7-methoxy-4-oxo-3,1-benzoxazin-2-yl)-2-pyridinyl]-2,3-dihydropyrrol-4-yl]amino]ethanesulfinate.
| Compound Name | 2-[[1-[3-(5-ethyl-7-methoxy-4-oxo-3,1-benzoxazin-2-yl)-2-pyridinyl]-2,3-dihydropyrrol-4-yl]amino]ethanesulfinate |
|---|---|
| PubChem CID | 163454400 |
| Molecular Formula | C22H23N4O5S- |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 2-[[1-[3-(5-ethyl-7-methoxy-4-oxo-3,1-benzoxazin-2-yl)-2-pyridinyl]-2,3-dihydropyrrol-4-yl]amino]ethanesulfinate |
| SMILES | CCc1cc(OC)cc2nc(-c3cccnc3N3C=C(NCCS(=O)[O-])CC3)oc(=O)c12 |
| InChI | InChI=1S/C22H24N4O5S/c1-3-14-11-16(30-2)12-18-19(14)22(27)31-21(25-18)17-5-4-7-24-20(17)26-9-6-15(13-26)23-8-10-32(28)29/h4-5,7,11-13,23H,3,6,8-10H2,1-2H3,(H,28,29)/p-1 |
| InChIKey | YWKQXGWQHLMUKY-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|