C8H14N2O — CID 163454767
(3R,6S)-2,3,4,5,6,7-hexahydro-1-benzofuran-3,6-diamine (PubChem CID 163454767) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (3R,6S)-2,3,4,5,6,7-hexahydro-1-benzofuran-3,6-diamine.
| Compound Name | (3R,6S)-2,3,4,5,6,7-hexahydro-1-benzofuran-3,6-diamine |
|---|---|
| PubChem CID | 163454767 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (3R,6S)-2,3,4,5,6,7-hexahydro-1-benzofuran-3,6-diamine |
| SMILES | N[C@H]1CCC2=C(C1)OC[C@@H]2N |
| InChI | InChI=1S/C8H14N2O/c9-5-1-2-6-7(10)4-11-8(6)3-5/h5,7H,1-4,9-10H2/t5-,7-/m0/s1 |
| InChIKey | BJMVRQOYVLBVES-FSPLSTOPSA-N |
| XLogP | 0.11 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |