C9H8F2N4O — CID 163455806
5,5-difluoro-4-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one (PubChem CID 163455806) has the molecular formula C9H8F2N4O and a molecular weight of 226.19 g/mol. Its IUPAC name is 5,5-difluoro-4-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one.
| Compound Name | 5,5-difluoro-4-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one |
|---|---|
| PubChem CID | 163455806 |
| Molecular Formula | C9H8F2N4O |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 5,5-difluoro-4-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-trien-3-one |
| SMILES | CC12C(=O)Nc3ncnc(c31)NCC2(F)F |
| InChI | InChI=1S/C9H8F2N4O/c1-8-4-5(12-2-9(8,10)11)13-3-14-6(4)15-7(8)16/h3H,2H2,1H3,(H2,12,13,14,15,16) |
| InChIKey | BKJHOVRKYMWYTI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |