About 3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one
3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one (PubChem CID 163456239) has the molecular formula C15H11IN2O
and a molecular weight of 362.17 g/mol. Its IUPAC name is 3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 163456239 |
| Molecular Formula | C15H11IN2O |
| Molecular Weight | 362.17 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c(Cc2ccccc2)cnc2cc(I)ccn12 |
| InChI | InChI=1S/C15H11IN2O/c16-13-6-7-18-14(9-13)17-10-12(15(18)19)8-11-4-2-1-3-5-11/h1-7,9-10H,8H2 |
| InChIKey | BKSZQJMRKDLBHN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.17 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one (CID 163456239) is 3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one is O=c1c(Cc2ccccc2)cnc2cc(I)ccn12.
What is the InChIKey of 3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one?
The InChIKey is BKSZQJMRKDLBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11IN2O/c16-13-6-7-18-14(9-13)17-10-12(15(18)19)8-11-4-2-1-3-5-11/h1-7,9-10H,8H2.
What are the key properties of 3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one?
3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one has a molecular weight of 362.17 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-8-iodopyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 163456239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).