methyl (6S)-7-amino-6-methylheptanoate

C9H19NO2 — CID 163456420

IUPACmethyl (6S)-7-amino-6-methylheptanoate
SMILESCOC(=O)CCCC[C@H](C)CN
InChIInChI=1S/C9H19NO2/c1-8(7-10)5-3-4-6-9(11)12-2/h8H,3-7,10H2,1-2H3/t8-/m0/s1
InChIKeyBKWRCCNYLMWIFA-QMMMGPOBSA-N
MW173.26 g/mol
LogP1.31
Rot. Bonds6

About methyl (6S)-7-amino-6-methylheptanoate

methyl (6S)-7-amino-6-methylheptanoate (PubChem CID 163456420) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is methyl (6S)-7-amino-6-methylheptanoate.

Molecular Properties

Compound Namemethyl (6S)-7-amino-6-methylheptanoate
PubChem CID163456420
Molecular FormulaC9H19NO2
Molecular Weight173.26 g/mol
Exact Mass173.14
IUPAC Namemethyl (6S)-7-amino-6-methylheptanoate
SMILESCOC(=O)CCCC[C@H](C)CN
InChIInChI=1S/C9H19NO2/c1-8(7-10)5-3-4-6-9(11)12-2/h8H,3-7,10H2,1-2H3/t8-/m0/s1
InChIKeyBKWRCCNYLMWIFA-QMMMGPOBSA-N
XLogP1.31
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.26
LogP ≤ 51.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl (6S)-7-amino-6-methylheptanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (6S)-7-amino-6-methylheptanoate?
The IUPAC name of methyl (6S)-7-amino-6-methylheptanoate (CID 163456420) is methyl (6S)-7-amino-6-methylheptanoate.
What is the SMILES notation for methyl (6S)-7-amino-6-methylheptanoate?
The canonical SMILES for methyl (6S)-7-amino-6-methylheptanoate is COC(=O)CCCC[C@H](C)CN.
What is the InChIKey of methyl (6S)-7-amino-6-methylheptanoate?
The InChIKey is BKWRCCNYLMWIFA-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H19NO2/c1-8(7-10)5-3-4-6-9(11)12-2/h8H,3-7,10H2,1-2H3/t8-/m0/s1.
What are the key properties of methyl (6S)-7-amino-6-methylheptanoate?
methyl (6S)-7-amino-6-methylheptanoate has a molecular weight of 173.26 g/mol, XLogP of 1.31, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (6S)-7-amino-6-methylheptanoate is sourced from PubChem (CID 163456420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).