C16H11IN2O2S2 — CID 163456625
N-(2-iodoethyl)-7-oxo-3,10-dithia-1-azatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),4,8,11,13,15-hexaene-8-carboxamide (PubChem CID 163456625) has the molecular formula C16H11IN2O2S2 and a molecular weight of 454.31 g/mol. Its IUPAC name is N-(2-iodoethyl)-7-oxo-3,10-dithia-1-azatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),4,8,11,13,15-hexaene-8-carboxamide.
| Compound Name | N-(2-iodoethyl)-7-oxo-3,10-dithia-1-azatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),4,8,11,13,15-hexaene-8-carboxamide |
|---|---|
| PubChem CID | 163456625 |
| Molecular Formula | C16H11IN2O2S2 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.93 |
| IUPAC Name | N-(2-iodoethyl)-7-oxo-3,10-dithia-1-azatetracyclo[7.7.0.02,6.011,16]hexadeca-2(6),4,8,11,13,15-hexaene-8-carboxamide |
| SMILES | O=C(NCCI)c1c(=O)c2ccsc2n2c1sc1ccccc12 |
| InChI | InChI=1S/C16H11IN2O2S2/c17-6-7-18-14(21)12-13(20)9-5-8-22-15(9)19-10-3-1-2-4-11(10)23-16(12)19/h1-5,8H,6-7H2,(H,18,21) |
| InChIKey | BLBDHJSKTUTWKY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 50.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|