About 1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol
1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol (PubChem CID 163456874) has the molecular formula C10H16OS2
and a molecular weight of 216.37 g/mol. Its IUPAC name is 1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol.
Molecular Properties
| Compound Name | 1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol |
| PubChem CID | 163456874 |
| Molecular Formula | C10H16OS2 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol |
| SMILES | CC(O)[C@H]1C=CCC2(C1)SCCS2 |
| InChI | InChI=1S/C10H16OS2/c1-8(11)9-3-2-4-10(7-9)12-5-6-13-10/h2-3,8-9,11H,4-7H2,1H3/t8?,9-/m0/s1 |
| InChIKey | BLFHWWNWEAUKML-GKAPJAKFSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol?
The IUPAC name of 1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol (CID 163456874) is 1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol.
What is the SMILES notation for 1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol?
The canonical SMILES for 1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol is CC(O)[C@H]1C=CCC2(C1)SCCS2.
What is the InChIKey of 1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol?
The InChIKey is BLFHWWNWEAUKML-GKAPJAKFSA-N. The full InChI is InChI=1S/C10H16OS2/c1-8(11)9-3-2-4-10(7-9)12-5-6-13-10/h2-3,8-9,11H,4-7H2,1H3/t8?,9-/m0/s1.
What are the key properties of 1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol?
1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol has a molecular weight of 216.37 g/mol, XLogP of 2.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(7R)-1,4-dithiaspiro[4.5]dec-8-en-7-yl]ethanol is sourced from PubChem (CID 163456874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).