C21H25N7O14P2-2 — CID 163457799
[[(2R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-2,3-dihydrofuran-5-yl]methoxy-oxidophosphoryl] [(2R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 163457799) has the molecular formula C21H25N7O14P2-2 and a molecular weight of 661.41 g/mol. Its IUPAC name is [[(2R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-2,3-dihydrofuran-5-yl]methoxy-oxidophosphoryl] [(2R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | [[(2R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-2,3-dihydrofuran-5-yl]methoxy-oxidophosphoryl] [(2R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 163457799 |
| Molecular Formula | C21H25N7O14P2-2 |
| Molecular Weight | 661.41 g/mol |
| Exact Mass | 661.09 |
| IUPAC Name | [[(2R)-2-(6-aminopurin-9-yl)-3,4-dihydroxy-2,3-dihydrofuran-5-yl]methoxy-oxidophosphoryl] [(2R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | NC(=O)C1=CN([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])OCC3=C(O)C(O)[C@H](n4cnc5c(N)ncnc54)O3)C(O)C2O)C=CC1 |
| InChI | InChI=1S/C21H27N7O14P2/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(32)14(30)11(41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15(31)20(40-10)27-3-1-2-9(4-27)18(23)33/h1,3-4,7-8,10,13,15-16,20-21,29-32H,2,5-6H2,(H2,23,33)(H,34,35)(H,36,37)(H2,22,24,25)/p-2/t10-,13?,15?,16?,20-,21-/m1/s1 |
| InChIKey | BLYHOBAHTYUTJV-XVCSDTOUSA-L |
| XLogP | -2.91 |
| TPSA | 323.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.41 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|