About 2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium
2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium (PubChem CID 163458014) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is 2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium.
Molecular Properties
| Compound Name | 2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium |
| PubChem CID | 163458014 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium |
| SMILES | CC1CC(C)[NH+]([O-])C(C)N1 |
| InChI | InChI=1S/C7H16N2O/c1-5-4-6(2)9(10)7(3)8-5/h5-9H,4H2,1-3H3 |
| InChIKey | BMCZUMCJRRULKF-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 39.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium?
The IUPAC name of 2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium (CID 163458014) is 2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium.
What is the SMILES notation for 2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium?
The canonical SMILES for 2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium is CC1CC(C)[NH+]([O-])C(C)N1.
What is the InChIKey of 2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium?
The InChIKey is BMCZUMCJRRULKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O/c1-5-4-6(2)9(10)7(3)8-5/h5-9H,4H2,1-3H3.
What are the key properties of 2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium?
2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium has a molecular weight of 144.22 g/mol, XLogP of -0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trimethyl-1-oxido-1,3-diazinan-1-ium is sourced from PubChem (CID 163458014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).