C40H28N3O+ — CID 163458235
[(Z)-4-imino-4-phenyl-1-(6-spiro[fluorene-9,9'-xanthene]-3'-yl-2-pyridinyl)but-2-enylidene]azanium (PubChem CID 163458235) has the molecular formula C40H28N3O+ and a molecular weight of 566.68 g/mol. Its IUPAC name is [(Z)-4-imino-4-phenyl-1-(6-spiro[fluorene-9,9'-xanthene]-3'-yl-2-pyridinyl)but-2-enylidene]azanium.
| Compound Name | [(Z)-4-imino-4-phenyl-1-(6-spiro[fluorene-9,9'-xanthene]-3'-yl-2-pyridinyl)but-2-enylidene]azanium |
|---|---|
| PubChem CID | 163458235 |
| Molecular Formula | C40H28N3O+ |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | [(Z)-4-imino-4-phenyl-1-(6-spiro[fluorene-9,9'-xanthene]-3'-yl-2-pyridinyl)but-2-enylidene]azanium |
| SMILES | [H]/N=C(/C=C\C(=[NH2+])c1cccc(-c2ccc3c(c2)Oc2ccccc2C32c3ccccc3-c3ccccc32)n1)c1ccccc1 |
| InChI | InChI=1S/C40H27N3O/c41-34(26-11-2-1-3-12-26)23-24-35(42)37-19-10-18-36(43-37)27-21-22-33-39(25-27)44-38-20-9-8-17-32(38)40(33)30-15-6-4-13-28(30)29-14-5-7-16-31(29)40/h1-25,41-42H/p+1/b24-23-,41-34-,42-35? |
| InChIKey | BMIFADSAJBIRSF-ARFJGXONSA-O |
| XLogP | 7.39 |
| TPSA | 71.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|