About 1,2,4-trinitrosobenzene
1,2,4-trinitrosobenzene (PubChem CID 163458443) has the molecular formula C6H3N3O3
and a molecular weight of 165.11 g/mol. Its IUPAC name is 1,2,4-trinitrosobenzene.
Molecular Properties
| Compound Name | 1,2,4-trinitrosobenzene |
| PubChem CID | 163458443 |
| Molecular Formula | C6H3N3O3 |
| Molecular Weight | 165.11 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 1,2,4-trinitrosobenzene |
| SMILES | O=Nc1ccc(N=O)c(N=O)c1 |
| InChI | InChI=1S/C6H3N3O3/c10-7-4-1-2-5(8-11)6(3-4)9-12/h1-3H |
| InChIKey | BMMYNCAPBUPWDK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.11 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,2,4-trinitrosobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-trinitrosobenzene?
The IUPAC name of 1,2,4-trinitrosobenzene (CID 163458443) is 1,2,4-trinitrosobenzene.
What is the SMILES notation for 1,2,4-trinitrosobenzene?
The canonical SMILES for 1,2,4-trinitrosobenzene is O=Nc1ccc(N=O)c(N=O)c1.
What is the InChIKey of 1,2,4-trinitrosobenzene?
The InChIKey is BMMYNCAPBUPWDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3O3/c10-7-4-1-2-5(8-11)6(3-4)9-12/h1-3H.
What are the key properties of 1,2,4-trinitrosobenzene?
1,2,4-trinitrosobenzene has a molecular weight of 165.11 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-trinitrosobenzene is sourced from PubChem (CID 163458443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).