About 5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine
5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine (PubChem CID 163458658) has the molecular formula C10H16BrN
and a molecular weight of 230.15 g/mol. Its IUPAC name is 5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 163458658 |
| Molecular Formula | C10H16BrN |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine |
| SMILES | CCN(CC)C1=CCCC(Br)=C1 |
| InChI | InChI=1S/C10H16BrN/c1-3-12(4-2)10-7-5-6-9(11)8-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | BMRXJGDASYPXDL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine (CID 163458658) is 5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine is CCN(CC)C1=CCCC(Br)=C1.
What is the InChIKey of 5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine?
The InChIKey is BMRXJGDASYPXDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16BrN/c1-3-12(4-2)10-7-5-6-9(11)8-10/h7-8H,3-6H2,1-2H3.
What are the key properties of 5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine?
5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine has a molecular weight of 230.15 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N,N-diethylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 163458658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).