About 5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine
5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine (PubChem CID 163458975) has the molecular formula C7H13N2S+
and a molecular weight of 157.26 g/mol. Its IUPAC name is 5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine.
Molecular Properties
| Compound Name | 5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine |
| PubChem CID | 163458975 |
| Molecular Formula | C7H13N2S+ |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.08 |
| IUPAC Name | 5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine |
| SMILES | CC=CC1=C(C)SC(N)[NH2+]1 |
| InChI | InChI=1S/C7H12N2S/c1-3-4-6-5(2)10-7(8)9-6/h3-4,7,9H,8H2,1-2H3/p+1 |
| InChIKey | BMXRUSXAGKHIRZ-UHFFFAOYSA-O |
| XLogP | 0.35 |
| TPSA | 42.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine?
The IUPAC name of 5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine (CID 163458975) is 5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine.
What is the SMILES notation for 5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine?
The canonical SMILES for 5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine is CC=CC1=C(C)SC(N)[NH2+]1.
What is the InChIKey of 5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine?
The InChIKey is BMXRUSXAGKHIRZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H12N2S/c1-3-4-6-5(2)10-7(8)9-6/h3-4,7,9H,8H2,1-2H3/p+1.
What are the key properties of 5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine?
5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine has a molecular weight of 157.26 g/mol, XLogP of 0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-prop-1-enyl-2,3-dihydro-1,3-thiazol-3-ium-2-amine is sourced from PubChem (CID 163458975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).