C29H25NO6Si — CID 163460193
6,11,16-trimethoxy-22-(4-methoxyphenyl)-1-methyl-8,14-dioxa-22-aza-1-silahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene (PubChem CID 163460193) has the molecular formula C29H25NO6Si and a molecular weight of 511.61 g/mol. Its IUPAC name is 6,11,16-trimethoxy-22-(4-methoxyphenyl)-1-methyl-8,14-dioxa-22-aza-1-silahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene.
| Compound Name | 6,11,16-trimethoxy-22-(4-methoxyphenyl)-1-methyl-8,14-dioxa-22-aza-1-silahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 163460193 |
| Molecular Formula | C29H25NO6Si |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 6,11,16-trimethoxy-22-(4-methoxyphenyl)-1-methyl-8,14-dioxa-22-aza-1-silahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene |
| SMILES | COc1ccc(N2c3ccc(OC)c4c3[Si]3(C)c5c(cc(OC)cc5Oc5c(OC)ccc2c53)O4)cc1 |
| InChI | InChI=1S/C29H25NO6Si/c1-31-17-8-6-16(7-9-17)30-19-10-12-21(33-3)25-27(19)37(5)28-20(30)11-13-22(34-4)26(28)36-24-15-18(32-2)14-23(35-25)29(24)37/h6-15H,1-5H3 |
| InChIKey | BNXAXNUFEUFOOD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|