C13H18F6O5S — CID 163460497
[3-[2-(1,1-dioxothian-4-yl)ethoxy]-1,1,1-trifluoropropan-2-yl] 3,3,3-trifluoropropanoate (PubChem CID 163460497) has the molecular formula C13H18F6O5S and a molecular weight of 400.34 g/mol. Its IUPAC name is [3-[2-(1,1-dioxothian-4-yl)ethoxy]-1,1,1-trifluoropropan-2-yl] 3,3,3-trifluoropropanoate.
| Compound Name | [3-[2-(1,1-dioxothian-4-yl)ethoxy]-1,1,1-trifluoropropan-2-yl] 3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 163460497 |
| Molecular Formula | C13H18F6O5S |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | [3-[2-(1,1-dioxothian-4-yl)ethoxy]-1,1,1-trifluoropropan-2-yl] 3,3,3-trifluoropropanoate |
| SMILES | O=C(CC(F)(F)F)OC(COCCC1CCS(=O)(=O)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H18F6O5S/c14-12(15,16)7-11(20)24-10(13(17,18)19)8-23-4-1-9-2-5-25(21,22)6-3-9/h9-10H,1-8H2 |
| InChIKey | HFWOEEHUDSKXHH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|