C15H23F5O5S — CID 163460498
[1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3-difluorobutan-2-yl] 3,3,3-trifluoro-2-methylpropanoate (PubChem CID 163460498) has the molecular formula C15H23F5O5S and a molecular weight of 410.40 g/mol. Its IUPAC name is [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3-difluorobutan-2-yl] 3,3,3-trifluoro-2-methylpropanoate.
| Compound Name | [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3-difluorobutan-2-yl] 3,3,3-trifluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 163460498 |
| Molecular Formula | C15H23F5O5S |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3-difluorobutan-2-yl] 3,3,3-trifluoro-2-methylpropanoate |
| SMILES | CC(C(=O)OC(COCCC1CCS(=O)(=O)CC1)C(C)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H23F5O5S/c1-10(15(18,19)20)13(21)25-12(14(2,16)17)9-24-6-3-11-4-7-26(22,23)8-5-11/h10-12H,3-9H2,1-2H3 |
| InChIKey | KIFUQKBNUZCMSL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|