C15H20F8O5S — CID 163460499
[1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5,5-pentafluoropentan-2-yl] 3,3,3-trifluoropropanoate (PubChem CID 163460499) has the molecular formula C15H20F8O5S and a molecular weight of 464.37 g/mol. Its IUPAC name is [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5,5-pentafluoropentan-2-yl] 3,3,3-trifluoropropanoate.
| Compound Name | [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5,5-pentafluoropentan-2-yl] 3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 163460499 |
| Molecular Formula | C15H20F8O5S |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | [1-[2-(1,1-dioxothian-4-yl)ethoxy]-3,3,5,5,5-pentafluoropentan-2-yl] 3,3,3-trifluoropropanoate |
| SMILES | O=C(CC(F)(F)F)OC(COCCC1CCS(=O)(=O)CC1)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C15H20F8O5S/c16-13(17,9-15(21,22)23)11(28-12(24)7-14(18,19)20)8-27-4-1-10-2-5-29(25,26)6-3-10/h10-11H,1-9H2 |
| InChIKey | AUIDNOJRWXPHEQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|