C20H14N2O8 — CID 163460549
(1S,3S)-3-acetyl-3,10-dihydroxy-12-hydroxyimino-1-nitroso-2,4-dihydro-1H-tetracene-5,6,11-trione (PubChem CID 163460549) has the molecular formula C20H14N2O8 and a molecular weight of 410.34 g/mol. Its IUPAC name is (1S,3S)-3-acetyl-3,10-dihydroxy-12-hydroxyimino-1-nitroso-2,4-dihydro-1H-tetracene-5,6,11-trione.
| Compound Name | (1S,3S)-3-acetyl-3,10-dihydroxy-12-hydroxyimino-1-nitroso-2,4-dihydro-1H-tetracene-5,6,11-trione |
|---|---|
| PubChem CID | 163460549 |
| Molecular Formula | C20H14N2O8 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (1S,3S)-3-acetyl-3,10-dihydroxy-12-hydroxyimino-1-nitroso-2,4-dihydro-1H-tetracene-5,6,11-trione |
| SMILES | CC(=O)[C@]1(O)Cc2c(c(=NO)c3c(=O)c4c(O)cccc4c(=O)c=3c2=O)[C@@H](N=O)C1 |
| InChI | InChI=1S/C20H14N2O8/c1-7(23)20(28)5-9-12(10(6-20)21-29)16(22-30)14-15(18(9)26)17(25)8-3-2-4-11(24)13(8)19(14)27/h2-4,10,24,28,30H,5-6H2,1H3/t10-,20-/m0/s1 |
| InChIKey | LTIGRNLIUMPDFB-FVINQWEUSA-N |
| XLogP | -0.41 |
| TPSA | 170.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|