C19H19N3O3S2 — CID 163460836
pyridin-3-ylmethyl 2-[(4-methoxy-2-methylphenyl)carbamothioyl]-4,5-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 163460836) has the molecular formula C19H19N3O3S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is pyridin-3-ylmethyl 2-[(4-methoxy-2-methylphenyl)carbamothioyl]-4,5-dihydro-1,3-thiazole-4-carboxylate.
| Compound Name | pyridin-3-ylmethyl 2-[(4-methoxy-2-methylphenyl)carbamothioyl]-4,5-dihydro-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 163460836 |
| Molecular Formula | C19H19N3O3S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | pyridin-3-ylmethyl 2-[(4-methoxy-2-methylphenyl)carbamothioyl]-4,5-dihydro-1,3-thiazole-4-carboxylate |
| SMILES | COc1ccc(NC(=S)C2=NC(C(=O)OCc3cccnc3)CS2)c(C)c1 |
| InChI | InChI=1S/C19H19N3O3S2/c1-12-8-14(24-2)5-6-15(12)21-17(26)18-22-16(11-27-18)19(23)25-10-13-4-3-7-20-9-13/h3-9,16H,10-11H2,1-2H3,(H,21,26) |
| InChIKey | BOKHAOHVXZVDFU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|