C21H26N4O3S — CID 163461188
7,13-diethyl-9-methyl-14-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]-5-oxa-2,9,15-triazatricyclo[8.5.0.02,7]pentadeca-1(15),10,13-trien-8-one (PubChem CID 163461188) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is 7,13-diethyl-9-methyl-14-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]-5-oxa-2,9,15-triazatricyclo[8.5.0.02,7]pentadeca-1(15),10,13-trien-8-one.
| Compound Name | 7,13-diethyl-9-methyl-14-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]-5-oxa-2,9,15-triazatricyclo[8.5.0.02,7]pentadeca-1(15),10,13-trien-8-one |
|---|---|
| PubChem CID | 163461188 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 7,13-diethyl-9-methyl-14-[2-oxo-2-(1,3-thiazol-2-yl)ethyl]-5-oxa-2,9,15-triazatricyclo[8.5.0.02,7]pentadeca-1(15),10,13-trien-8-one |
| SMILES | CCC1=C(CC(=O)c2nccs2)N=C2C(=CC1)N(C)C(=O)C1(CC)COCCN21 |
| InChI | InChI=1S/C21H26N4O3S/c1-4-14-6-7-16-18(23-15(14)12-17(26)19-22-8-11-29-19)25-9-10-28-13-21(25,5-2)20(27)24(16)3/h7-8,11H,4-6,9-10,12-13H2,1-3H3 |
| InChIKey | BORYHCFLRKADDI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 75.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |