C35H44ClN3O3 — CID 163461256
1-[3-[5-(4-chlorophenoxy)pentyl-propylamino]propyl]-7-methoxy-N-[(3-methylphenyl)methyl]indole-3-carboxamide (PubChem CID 163461256) has the molecular formula C35H44ClN3O3 and a molecular weight of 590.21 g/mol. Its IUPAC name is 1-[3-[5-(4-chlorophenoxy)pentyl-propylamino]propyl]-7-methoxy-N-[(3-methylphenyl)methyl]indole-3-carboxamide.
| Compound Name | 1-[3-[5-(4-chlorophenoxy)pentyl-propylamino]propyl]-7-methoxy-N-[(3-methylphenyl)methyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 163461256 |
| Molecular Formula | C35H44ClN3O3 |
| Molecular Weight | 590.21 g/mol |
| Exact Mass | 589.31 |
| IUPAC Name | 1-[3-[5-(4-chlorophenoxy)pentyl-propylamino]propyl]-7-methoxy-N-[(3-methylphenyl)methyl]indole-3-carboxamide |
| SMILES | CCCN(CCCCCOc1ccc(Cl)cc1)CCCn1cc(C(=O)NCc2cccc(C)c2)c2cccc(OC)c21 |
| InChI | InChI=1S/C35H44ClN3O3/c1-4-19-38(20-6-5-7-23-42-30-17-15-29(36)16-18-30)21-10-22-39-26-32(31-13-9-14-33(41-3)34(31)39)35(40)37-25-28-12-8-11-27(2)24-28/h8-9,11-18,24,26H,4-7,10,19-23,25H2,1-3H3,(H,37,40) |
| InChIKey | BOTPVBCDXPTFDE-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.21 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|