C9H12F2O — CID 163461424
(3Z,5Z)-5-ethoxy-3,4-difluorohepta-1,3,5-triene (PubChem CID 163461424) has the molecular formula C9H12F2O and a molecular weight of 174.19 g/mol. Its IUPAC name is (3Z,5Z)-5-ethoxy-3,4-difluorohepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-5-ethoxy-3,4-difluorohepta-1,3,5-triene |
|---|---|
| PubChem CID | 163461424 |
| Molecular Formula | C9H12F2O |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (3Z,5Z)-5-ethoxy-3,4-difluorohepta-1,3,5-triene |
| SMILES | C=C/C(F)=C(F)\C(=C\C)OCC |
| InChI | InChI=1S/C9H12F2O/c1-4-7(10)9(11)8(5-2)12-6-3/h4-5H,1,6H2,2-3H3/b8-5-,9-7- |
| InChIKey | BOXBSUXSAAJOOR-IOUWKBNPSA-N |
| XLogP | 3.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|