About carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium
carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium (PubChem CID 163461785) has the molecular formula C9H18Y-2
and a molecular weight of 215.15 g/mol. Its IUPAC name is carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium.
Molecular Properties
| Compound Name | carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium |
| PubChem CID | 163461785 |
| Molecular Formula | C9H18Y-2 |
| Molecular Weight | 215.15 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium |
| SMILES | CCC1[CH-]C(C)[C@@H]1C.[CH3-].[Y] |
| InChI | InChI=1S/C8H15.CH3.Y/c1-4-8-5-6(2)7(8)3;;/h5-8H,4H2,1-3H3;1H3;/q2*-1;/t6?,7-,8?;;/m0../s1 |
| InChIKey | KMIYXIJURZEDGV-QUBGZHGSSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.15 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium?
The IUPAC name of carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium (CID 163461785) is carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium.
What is the SMILES notation for carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium?
The canonical SMILES for carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium is CCC1[CH-]C(C)[C@@H]1C.[CH3-].[Y].
What is the InChIKey of carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium?
The InChIKey is KMIYXIJURZEDGV-QUBGZHGSSA-N. The full InChI is InChI=1S/C8H15.CH3.Y/c1-4-8-5-6(2)7(8)3;;/h5-8H,4H2,1-3H3;1H3;/q2*-1;/t6?,7-,8?;;/m0../s1.
What are the key properties of carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium?
carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium has a molecular weight of 215.15 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(2S)-1-ethyl-2,3-dimethylcyclobutane;yttrium is sourced from PubChem (CID 163461785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).