About [5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine
[5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine (PubChem CID 163461887) has the molecular formula C12H18F3NO
and a molecular weight of 249.28 g/mol. Its IUPAC name is [5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine.
Molecular Properties
| Compound Name | [5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine |
| PubChem CID | 163461887 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | [5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine |
| SMILES | CC(F)(F)CCOC1=CC=CC(CN)C1(C)F |
| InChI | InChI=1S/C12H18F3NO/c1-11(13,14)6-7-17-10-5-3-4-9(8-16)12(10,2)15/h3-5,9H,6-8,16H2,1-2H3 |
| InChIKey | BPHGIAUHMSSAAQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine?
The IUPAC name of [5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine (CID 163461887) is [5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine.
What is the SMILES notation for [5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine?
The canonical SMILES for [5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine is CC(F)(F)CCOC1=CC=CC(CN)C1(C)F.
What is the InChIKey of [5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine?
The InChIKey is BPHGIAUHMSSAAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3NO/c1-11(13,14)6-7-17-10-5-3-4-9(8-16)12(10,2)15/h3-5,9H,6-8,16H2,1-2H3.
What are the key properties of [5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine?
[5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine has a molecular weight of 249.28 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,3-difluorobutoxy)-6-fluoro-6-methylcyclohexa-2,4-dien-1-yl]methanamine is sourced from PubChem (CID 163461887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).