C30H42O9S2 — CID 163462631
[(2R)-2-(hydroxymethyl)pent-4-enyl] 2,4,6-trimethylbenzenesulfonate;(2S)-2-[(2,4,6-trimethylphenyl)sulfonyloxymethyl]pent-4-enoic acid (PubChem CID 163462631) has the molecular formula C30H42O9S2 and a molecular weight of 610.79 g/mol. Its IUPAC name is [(2R)-2-(hydroxymethyl)pent-4-enyl] 2,4,6-trimethylbenzenesulfonate;(2S)-2-[(2,4,6-trimethylphenyl)sulfonyloxymethyl]pent-4-enoic acid.
| Compound Name | [(2R)-2-(hydroxymethyl)pent-4-enyl] 2,4,6-trimethylbenzenesulfonate;(2S)-2-[(2,4,6-trimethylphenyl)sulfonyloxymethyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 163462631 |
| Molecular Formula | C30H42O9S2 |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | [(2R)-2-(hydroxymethyl)pent-4-enyl] 2,4,6-trimethylbenzenesulfonate;(2S)-2-[(2,4,6-trimethylphenyl)sulfonyloxymethyl]pent-4-enoic acid |
| SMILES | C=CC[C@@H](COS(=O)(=O)c1c(C)cc(C)cc1C)C(=O)O.C=CC[C@H](CO)COS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H20O5S.C15H22O4S/c1-5-6-13(15(16)17)9-20-21(18,19)14-11(3)7-10(2)8-12(14)4;1-5-6-14(9-16)10-19-20(17,18)15-12(3)7-11(2)8-13(15)4/h5,7-8,13H,1,6,9H2,2-4H3,(H,16,17);5,7-8,14,16H,1,6,9-10H2,2-4H3/t13-;14-/m01/s1 |
| InChIKey | BPWYRGOXHSIAAQ-NLDBRWKZSA-N |
| XLogP | 5.10 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|