About (4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine
(4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine (PubChem CID 163462739) has the molecular formula C8H19N3
and a molecular weight of 157.26 g/mol. Its IUPAC name is (4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | (4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine |
| PubChem CID | 163462739 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | (4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine |
| SMILES | CC1C[C@@H](C)CC(NN)C1N |
| InChI | InChI=1S/C8H19N3/c1-5-3-6(2)8(9)7(4-5)11-10/h5-8,11H,3-4,9-10H2,1-2H3/t5-,6?,7?,8?/m1/s1 |
| InChIKey | BPZLGMJFSQTDRH-NIYQRSRNSA-N |
| XLogP | 0.21 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine?
The IUPAC name of (4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine (CID 163462739) is (4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine.
What is the SMILES notation for (4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine?
The canonical SMILES for (4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine is CC1C[C@@H](C)CC(NN)C1N.
What is the InChIKey of (4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine?
The InChIKey is BPZLGMJFSQTDRH-NIYQRSRNSA-N. The full InChI is InChI=1S/C8H19N3/c1-5-3-6(2)8(9)7(4-5)11-10/h5-8,11H,3-4,9-10H2,1-2H3/t5-,6?,7?,8?/m1/s1.
What are the key properties of (4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine?
(4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine has a molecular weight of 157.26 g/mol, XLogP of 0.21, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-hydrazinyl-4,6-dimethylcyclohexan-1-amine is sourced from PubChem (CID 163462739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).