About CID 163462988
CID 163462988 (PubChem CID 163462988) has the molecular formula C14H20
and a molecular weight of 188.31 g/mol.
Molecular Properties
| Compound Name | CID 163462988 |
| PubChem CID | 163462988 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | — |
| SMILES | C[C@H]1C2(CC2)C2CC2C2(CC2)C12CC2 |
| InChI | InChI=1S/C14H20/c1-9-12(2-3-12)10-8-11(10)14(6-7-14)13(9)4-5-13/h9-11H,2-8H2,1H3/t9-,10?,11?/m0/s1 |
| InChIKey | BQEWFQALEKCRKR-WHXUTIOJSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 163462988 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163462988?
The IUPAC name of CID 163462988 (CID 163462988) is not available.
What is the SMILES notation for CID 163462988?
The canonical SMILES for CID 163462988 is C[C@H]1C2(CC2)C2CC2C2(CC2)C12CC2.
What is the InChIKey of CID 163462988?
The InChIKey is BQEWFQALEKCRKR-WHXUTIOJSA-N. The full InChI is InChI=1S/C14H20/c1-9-12(2-3-12)10-8-11(10)14(6-7-14)13(9)4-5-13/h9-11H,2-8H2,1H3/t9-,10?,11?/m0/s1.
What are the key properties of CID 163462988?
CID 163462988 has a molecular weight of 188.31 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163462988 is sourced from PubChem (CID 163462988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).