C12H19F3N2O2 — CID 163463287
2,2,2-trifluoroethyl N-[(Z,2S,4Z)-1-amino-4-ethylidenehept-5-en-2-yl]carbamate (PubChem CID 163463287) has the molecular formula C12H19F3N2O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[(Z,2S,4Z)-1-amino-4-ethylidenehept-5-en-2-yl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[(Z,2S,4Z)-1-amino-4-ethylidenehept-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 163463287 |
| Molecular Formula | C12H19F3N2O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[(Z,2S,4Z)-1-amino-4-ethylidenehept-5-en-2-yl]carbamate |
| SMILES | C/C=C\C(=C/C)C[C@@H](CN)NC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C12H19F3N2O2/c1-3-5-9(4-2)6-10(7-16)17-11(18)19-8-12(13,14)15/h3-5,10H,6-8,16H2,1-2H3,(H,17,18)/b5-3-,9-4+/t10-/m0/s1 |
| InChIKey | BQLLCPLELRWXRU-MNSSRJDHSA-N |
| XLogP | 2.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|